C17H24N6O4S2 — CID 24525841
N-tert-butyl-4-(1-cyclohexyltetrazol-5-yl)sulfanyl-3-nitrobenzenesulfonamide (PubChem CID 24525841) has the molecular formula C17H24N6O4S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is N-tert-butyl-4-(1-cyclohexyltetrazol-5-yl)sulfanyl-3-nitrobenzenesulfonamide.
| Compound Name | N-tert-butyl-4-(1-cyclohexyltetrazol-5-yl)sulfanyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 24525841 |
| Molecular Formula | C17H24N6O4S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | N-tert-butyl-4-(1-cyclohexyltetrazol-5-yl)sulfanyl-3-nitrobenzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(Sc2nnnn2C2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H24N6O4S2/c1-17(2,3)19-29(26,27)13-9-10-15(14(11-13)23(24)25)28-16-18-20-21-22(16)12-7-5-4-6-8-12/h9-12,19H,4-8H2,1-3H3 |
| InChIKey | GRQQGZQCRYSZLD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|