C21H27N5O4S2 — CID 46682350
4-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-methylcyclohexyl)-3-nitrobenzenesulfonamide (PubChem CID 46682350) has the molecular formula C21H27N5O4S2 and a molecular weight of 477.61 g/mol. Its IUPAC name is 4-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-methylcyclohexyl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-methylcyclohexyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 46682350 |
| Molecular Formula | C21H27N5O4S2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 4-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-methylcyclohexyl)-3-nitrobenzenesulfonamide |
| SMILES | CC1CCC(NS(=O)(=O)c2ccc(Sc3nnc(C4CC4)n3C3CC3)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C21H27N5O4S2/c1-13-2-6-15(7-3-13)24-32(29,30)17-10-11-19(18(12-17)26(27)28)31-21-23-22-20(14-4-5-14)25(21)16-8-9-16/h10-16,24H,2-9H2,1H3 |
| InChIKey | OVYLPIWFOASQNY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|