C22H35N5O5S — CID 52521120
(3S)-1-[3-[4-[(4-methylcyclohexyl)sulfamoyl]-2-nitroanilino]propyl]piperidine-3-carboxamide (PubChem CID 52521120) has the molecular formula C22H35N5O5S and a molecular weight of 481.62 g/mol. Its IUPAC name is (3S)-1-[3-[4-[(4-methylcyclohexyl)sulfamoyl]-2-nitroanilino]propyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-[3-[4-[(4-methylcyclohexyl)sulfamoyl]-2-nitroanilino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 52521120 |
| Molecular Formula | C22H35N5O5S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | (3S)-1-[3-[4-[(4-methylcyclohexyl)sulfamoyl]-2-nitroanilino]propyl]piperidine-3-carboxamide |
| SMILES | CC1CCC(NS(=O)(=O)c2ccc(NCCCN3CCC[C@H](C(N)=O)C3)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C22H35N5O5S/c1-16-5-7-18(8-6-16)25-33(31,32)19-9-10-20(21(14-19)27(29)30)24-11-3-13-26-12-2-4-17(15-26)22(23)28/h9-10,14,16-18,24-25H,2-8,11-13,15H2,1H3,(H2,23,28)/t16?,17-,18?/m0/s1 |
| InChIKey | MNTYLLFSEWAHFV-ADKAHSJRSA-N |
| XLogP | 2.45 |
| TPSA | 147.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|