C16H20N4O5S3 — CID 24574428
2-[2-[4-(tert-butylsulfamoyl)-2-nitrophenyl]sulfanyl-4-methyl-1,3-thiazol-5-yl]acetamide (PubChem CID 24574428) has the molecular formula C16H20N4O5S3 and a molecular weight of 444.56 g/mol. Its IUPAC name is 2-[2-[4-(tert-butylsulfamoyl)-2-nitrophenyl]sulfanyl-4-methyl-1,3-thiazol-5-yl]acetamide.
| Compound Name | 2-[2-[4-(tert-butylsulfamoyl)-2-nitrophenyl]sulfanyl-4-methyl-1,3-thiazol-5-yl]acetamide |
|---|---|
| PubChem CID | 24574428 |
| Molecular Formula | C16H20N4O5S3 |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 2-[2-[4-(tert-butylsulfamoyl)-2-nitrophenyl]sulfanyl-4-methyl-1,3-thiazol-5-yl]acetamide |
| SMILES | Cc1nc(Sc2ccc(S(=O)(=O)NC(C)(C)C)cc2[N+](=O)[O-])sc1CC(N)=O |
| InChI | InChI=1S/C16H20N4O5S3/c1-9-13(8-14(17)21)27-15(18-9)26-12-6-5-10(7-11(12)20(22)23)28(24,25)19-16(2,3)4/h5-7,19H,8H2,1-4H3,(H2,17,21) |
| InChIKey | IAMMTDHLBUWFJS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 145.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|