C12H10N2O4S2 — CID 29053781
2-[4-methyl-2-(2-nitrophenyl)sulfanyl-1,3-thiazol-5-yl]acetic acid (PubChem CID 29053781) has the molecular formula C12H10N2O4S2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 2-[4-methyl-2-(2-nitrophenyl)sulfanyl-1,3-thiazol-5-yl]acetic acid.
| Compound Name | 2-[4-methyl-2-(2-nitrophenyl)sulfanyl-1,3-thiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 29053781 |
| Molecular Formula | C12H10N2O4S2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 2-[4-methyl-2-(2-nitrophenyl)sulfanyl-1,3-thiazol-5-yl]acetic acid |
| SMILES | Cc1nc(Sc2ccccc2[N+](=O)[O-])sc1CC(=O)O |
| InChI | InChI=1S/C12H10N2O4S2/c1-7-10(6-11(15)16)20-12(13-7)19-9-5-3-2-4-8(9)14(17)18/h2-5H,6H2,1H3,(H,15,16) |
| InChIKey | YQVBJTMKQBODCK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|