C11H12N4O4S2 — CID 103554728
2-[2-(2,3-dimethyl-5-nitroimidazol-4-yl)sulfanyl-4-methyl-1,3-thiazol-5-yl]acetic acid (PubChem CID 103554728) has the molecular formula C11H12N4O4S2 and a molecular weight of 328.38 g/mol. Its IUPAC name is 2-[2-(2,3-dimethyl-5-nitroimidazol-4-yl)sulfanyl-4-methyl-1,3-thiazol-5-yl]acetic acid.
| Compound Name | 2-[2-(2,3-dimethyl-5-nitroimidazol-4-yl)sulfanyl-4-methyl-1,3-thiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 103554728 |
| Molecular Formula | C11H12N4O4S2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 2-[2-(2,3-dimethyl-5-nitroimidazol-4-yl)sulfanyl-4-methyl-1,3-thiazol-5-yl]acetic acid |
| SMILES | Cc1nc(Sc2c([N+](=O)[O-])nc(C)n2C)sc1CC(=O)O |
| InChI | InChI=1S/C11H12N4O4S2/c1-5-7(4-8(16)17)20-11(12-5)21-10-9(15(18)19)13-6(2)14(10)3/h4H2,1-3H3,(H,16,17) |
| InChIKey | CKIVBJKFEPJUKB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|