C6H6N2O4S — CID 83881121
2-(2-methyl-4-nitro-1,3-thiazol-5-yl)acetic acid (PubChem CID 83881121) has the molecular formula C6H6N2O4S and a molecular weight of 202.19 g/mol. Its IUPAC name is 2-(2-methyl-4-nitro-1,3-thiazol-5-yl)acetic acid.
| Compound Name | 2-(2-methyl-4-nitro-1,3-thiazol-5-yl)acetic acid |
|---|---|
| PubChem CID | 83881121 |
| Molecular Formula | C6H6N2O4S |
| Molecular Weight | 202.19 g/mol |
| Exact Mass | 202.00 |
| IUPAC Name | 2-(2-methyl-4-nitro-1,3-thiazol-5-yl)acetic acid |
| SMILES | Cc1nc([N+](=O)[O-])c(CC(=O)O)s1 |
| InChI | InChI=1S/C6H6N2O4S/c1-3-7-6(8(11)12)4(13-3)2-5(9)10/h2H2,1H3,(H,9,10) |
| InChIKey | SKTYFIXPOKMVCF-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.19 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|