2-(5-amino-2-methyl-1,3-thiazol-4-yl)acetic acid

C6H8N2O2S — CID 83777548

IUPAC2-(5-amino-2-methyl-1,3-thiazol-4-yl)acetic acid
SMILESCc1nc(CC(=O)O)c(N)s1
InChIInChI=1S/C6H8N2O2S/c1-3-8-4(2-5(9)10)6(7)11-3/h2,7H2,1H3,(H,9,10)
InChIKeyXBVQLTMSHSVUQV-UHFFFAOYSA-N
MW172.21 g/mol
LogP0.66
Rot. Bonds2

About 2-(5-amino-2-methyl-1,3-thiazol-4-yl)acetic acid

2-(5-amino-2-methyl-1,3-thiazol-4-yl)acetic acid (PubChem CID 83777548) has the molecular formula C6H8N2O2S and a molecular weight of 172.21 g/mol. Its IUPAC name is 2-(5-amino-2-methyl-1,3-thiazol-4-yl)acetic acid.

Molecular Properties

Compound Name2-(5-amino-2-methyl-1,3-thiazol-4-yl)acetic acid
PubChem CID83777548
Molecular FormulaC6H8N2O2S
Molecular Weight172.21 g/mol
Exact Mass172.03
IUPAC Name2-(5-amino-2-methyl-1,3-thiazol-4-yl)acetic acid
SMILESCc1nc(CC(=O)O)c(N)s1
InChIInChI=1S/C6H8N2O2S/c1-3-8-4(2-5(9)10)6(7)11-3/h2,7H2,1H3,(H,9,10)
InChIKeyXBVQLTMSHSVUQV-UHFFFAOYSA-N
XLogP0.66
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.21
LogP ≤ 50.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(5-amino-2-methyl-1,3-thiazol-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-amino-2-methyl-1,3-thiazol-4-yl)acetic acid?
The IUPAC name of 2-(5-amino-2-methyl-1,3-thiazol-4-yl)acetic acid (CID 83777548) is 2-(5-amino-2-methyl-1,3-thiazol-4-yl)acetic acid.
What is the SMILES notation for 2-(5-amino-2-methyl-1,3-thiazol-4-yl)acetic acid?
The canonical SMILES for 2-(5-amino-2-methyl-1,3-thiazol-4-yl)acetic acid is Cc1nc(CC(=O)O)c(N)s1.
What is the InChIKey of 2-(5-amino-2-methyl-1,3-thiazol-4-yl)acetic acid?
The InChIKey is XBVQLTMSHSVUQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c1-3-8-4(2-5(9)10)6(7)11-3/h2,7H2,1H3,(H,9,10).
What are the key properties of 2-(5-amino-2-methyl-1,3-thiazol-4-yl)acetic acid?
2-(5-amino-2-methyl-1,3-thiazol-4-yl)acetic acid has a molecular weight of 172.21 g/mol, XLogP of 0.66, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-amino-2-methyl-1,3-thiazol-4-yl)acetic acid is sourced from PubChem (CID 83777548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).