C12H15N3O2S2 — CID 61494530
2-[2-(3-imidazol-1-ylpropylsulfanyl)-4-methyl-1,3-thiazol-5-yl]acetic acid (PubChem CID 61494530) has the molecular formula C12H15N3O2S2 and a molecular weight of 297.41 g/mol. Its IUPAC name is 2-[2-(3-imidazol-1-ylpropylsulfanyl)-4-methyl-1,3-thiazol-5-yl]acetic acid.
| Compound Name | 2-[2-(3-imidazol-1-ylpropylsulfanyl)-4-methyl-1,3-thiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 61494530 |
| Molecular Formula | C12H15N3O2S2 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 2-[2-(3-imidazol-1-ylpropylsulfanyl)-4-methyl-1,3-thiazol-5-yl]acetic acid |
| SMILES | Cc1nc(SCCCn2ccnc2)sc1CC(=O)O |
| InChI | InChI=1S/C12H15N3O2S2/c1-9-10(7-11(16)17)19-12(14-9)18-6-2-4-15-5-3-13-8-15/h3,5,8H,2,4,6-7H2,1H3,(H,16,17) |
| InChIKey | HNHFPVXOSSXOCE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|