C12H10FN3O4S — CID 103554746
5-(2,3-dimethyl-5-nitroimidazol-4-yl)sulfanyl-2-fluorobenzoic acid (PubChem CID 103554746) has the molecular formula C12H10FN3O4S and a molecular weight of 311.29 g/mol. Its IUPAC name is 5-(2,3-dimethyl-5-nitroimidazol-4-yl)sulfanyl-2-fluorobenzoic acid.
| Compound Name | 5-(2,3-dimethyl-5-nitroimidazol-4-yl)sulfanyl-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 103554746 |
| Molecular Formula | C12H10FN3O4S |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 5-(2,3-dimethyl-5-nitroimidazol-4-yl)sulfanyl-2-fluorobenzoic acid |
| SMILES | Cc1nc([N+](=O)[O-])c(Sc2ccc(F)c(C(=O)O)c2)n1C |
| InChI | InChI=1S/C12H10FN3O4S/c1-6-14-10(16(19)20)11(15(6)2)21-7-3-4-9(13)8(5-7)12(17)18/h3-5H,1-2H3,(H,17,18) |
| InChIKey | WGJVHSXDECBUCJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|