C13H16N6OS — CID 63358609
4-amino-3-(1-cyclopropyltetrazol-5-yl)sulfanyl-N,N-dimethylbenzamide (PubChem CID 63358609) has the molecular formula C13H16N6OS and a molecular weight of 304.38 g/mol. Its IUPAC name is 4-amino-3-(1-cyclopropyltetrazol-5-yl)sulfanyl-N,N-dimethylbenzamide.
| Compound Name | 4-amino-3-(1-cyclopropyltetrazol-5-yl)sulfanyl-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 63358609 |
| Molecular Formula | C13H16N6OS |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 4-amino-3-(1-cyclopropyltetrazol-5-yl)sulfanyl-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(N)c(Sc2nnnn2C2CC2)c1 |
| InChI | InChI=1S/C13H16N6OS/c1-18(2)12(20)8-3-6-10(14)11(7-8)21-13-15-16-17-19(13)9-4-5-9/h3,6-7,9H,4-5,14H2,1-2H3 |
| InChIKey | QFNBTIAFDKRURH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|