C11H12N4OS2 — CID 63358698
4-amino-N,N-dimethyl-3-(1,3,4-thiadiazol-2-ylsulfanyl)benzamide (PubChem CID 63358698) has the molecular formula C11H12N4OS2 and a molecular weight of 280.38 g/mol. Its IUPAC name is 4-amino-N,N-dimethyl-3-(1,3,4-thiadiazol-2-ylsulfanyl)benzamide.
| Compound Name | 4-amino-N,N-dimethyl-3-(1,3,4-thiadiazol-2-ylsulfanyl)benzamide |
|---|---|
| PubChem CID | 63358698 |
| Molecular Formula | C11H12N4OS2 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 4-amino-N,N-dimethyl-3-(1,3,4-thiadiazol-2-ylsulfanyl)benzamide |
| SMILES | CN(C)C(=O)c1ccc(N)c(Sc2nncs2)c1 |
| InChI | InChI=1S/C11H12N4OS2/c1-15(2)10(16)7-3-4-8(12)9(5-7)18-11-14-13-6-17-11/h3-6H,12H2,1-2H3 |
| InChIKey | JHPHORGNTBQGBN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|