C10H12N4O2S3 — CID 82901187
4-amino-N-ethyl-3-(1,3,4-thiadiazol-2-ylsulfanyl)benzenesulfonamide (PubChem CID 82901187) has the molecular formula C10H12N4O2S3 and a molecular weight of 316.43 g/mol. Its IUPAC name is 4-amino-N-ethyl-3-(1,3,4-thiadiazol-2-ylsulfanyl)benzenesulfonamide.
| Compound Name | 4-amino-N-ethyl-3-(1,3,4-thiadiazol-2-ylsulfanyl)benzenesulfonamide |
|---|---|
| PubChem CID | 82901187 |
| Molecular Formula | C10H12N4O2S3 |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 4-amino-N-ethyl-3-(1,3,4-thiadiazol-2-ylsulfanyl)benzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(N)c(Sc2nncs2)c1 |
| InChI | InChI=1S/C10H12N4O2S3/c1-2-13-19(15,16)7-3-4-8(11)9(5-7)18-10-14-12-6-17-10/h3-6,13H,2,11H2,1H3 |
| InChIKey | YCONPZFHPFIBLS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|