C36H34S8 — CID 102472030
9-[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-6,8,10,12-tetrathiaheptacyclo[15.6.6.02,16.04,14.07,11.018,23.024,29]nonacosa-2(16),3,7(11),14,18,20,22,24,26,28-decaene (PubChem CID 102472030) has the molecular formula C36H34S8 and a molecular weight of 723.20 g/mol. Its IUPAC name is 9-[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-6,8,10,12-tetrathiaheptacyclo[15.6.6.02,16.04,14.07,11.018,23.024,29]nonacosa-2(16),3,7(11),14,18,20,22,24,26,28-decaene.
| Compound Name | 9-[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-6,8,10,12-tetrathiaheptacyclo[15.6.6.02,16.04,14.07,11.018,23.024,29]nonacosa-2(16),3,7(11),14,18,20,22,24,26,28-decaene |
|---|---|
| PubChem CID | 102472030 |
| Molecular Formula | C36H34S8 |
| Molecular Weight | 723.20 g/mol |
| Exact Mass | 722.04 |
| IUPAC Name | 9-[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-6,8,10,12-tetrathiaheptacyclo[15.6.6.02,16.04,14.07,11.018,23.024,29]nonacosa-2(16),3,7(11),14,18,20,22,24,26,28-decaene |
| SMILES | CCCCSC1=C(SCCCC)SC(=C2SC3=C(SCc4cc5c(cc4CS3)C3c4ccccc4C5c4ccccc43)S2)S1 |
| InChI | InChI=1S/C36H34S8/c1-3-5-15-37-31-32(38-16-6-4-2)42-35(41-31)36-43-33-34(44-36)40-20-22-18-28-27(17-21(22)19-39-33)29-23-11-7-8-12-24(23)30(28)26-14-10-9-13-25(26)29/h7-14,17-18,29-30H,3-6,15-16,19-20H2,1-2H3 |
| InChIKey | GCWBLAKXWVWITE-UHFFFAOYSA-N |
| XLogP | 13.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.20 |
| LogP ≤ 5 | 13.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|