C37H41NS12 — CID 132545155
2,6-bis[2-[2-[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-dithiol-4-yl]ethynyl]pyridine (PubChem CID 132545155) has the molecular formula C37H41NS12 and a molecular weight of 884.55 g/mol. Its IUPAC name is 2,6-bis[2-[2-[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-dithiol-4-yl]ethynyl]pyridine.
| Compound Name | 2,6-bis[2-[2-[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-dithiol-4-yl]ethynyl]pyridine |
|---|---|
| PubChem CID | 132545155 |
| Molecular Formula | C37H41NS12 |
| Molecular Weight | 884.55 g/mol |
| Exact Mass | 882.99 |
| IUPAC Name | 2,6-bis[2-[2-[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-dithiol-4-yl]ethynyl]pyridine |
| SMILES | CCCCSC1=C(SCCCC)SC(=C2SC=C(C#Cc3cccc(C#CC4=CSC(=C5SC(SCCCC)=C(SCCCC)S5)S4)n3)S2)S1 |
| InChI | InChI=1S/C37H41NS12/c1-5-9-20-39-30-31(40-21-10-6-2)48-36(47-30)34-43-24-28(45-34)18-16-26-14-13-15-27(38-26)17-19-29-25-44-35(46-29)37-49-32(41-22-11-7-3)33(50-37)42-23-12-8-4/h13-15,24-25H,5-12,20-23H2,1-4H3 |
| InChIKey | XHGRVDGAJKAACJ-UHFFFAOYSA-N |
| XLogP | 16.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.55 |
| LogP ≤ 5 | 16.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|