C30H26S12 — CID 102302600
2-[4-[2-[4-[2-[2-[4,5-bis(ethylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-dithiol-4-yl]ethynyl]phenyl]ethynyl]-1,3-dithiol-2-ylidene]-4,5-bis(ethylsulfanyl)-1,3-dithiole (PubChem CID 102302600) has the molecular formula C30H26S12 and a molecular weight of 771.34 g/mol. Its IUPAC name is 2-[4-[2-[4-[2-[2-[4,5-bis(ethylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-dithiol-4-yl]ethynyl]phenyl]ethynyl]-1,3-dithiol-2-ylidene]-4,5-bis(ethylsulfanyl)-1,3-dithiole.
| Compound Name | 2-[4-[2-[4-[2-[2-[4,5-bis(ethylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-dithiol-4-yl]ethynyl]phenyl]ethynyl]-1,3-dithiol-2-ylidene]-4,5-bis(ethylsulfanyl)-1,3-dithiole |
|---|---|
| PubChem CID | 102302600 |
| Molecular Formula | C30H26S12 |
| Molecular Weight | 771.34 g/mol |
| Exact Mass | 769.87 |
| IUPAC Name | 2-[4-[2-[4-[2-[2-[4,5-bis(ethylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-dithiol-4-yl]ethynyl]phenyl]ethynyl]-1,3-dithiol-2-ylidene]-4,5-bis(ethylsulfanyl)-1,3-dithiole |
| SMILES | CCSC1=C(SCC)SC(=C2SC=C(C#Cc3ccc(C#CC4=CSC(=C5SC(SCC)=C(SCC)S5)S4)cc3)S2)S1 |
| InChI | InChI=1S/C30H26S12/c1-5-31-23-24(32-6-2)40-29(39-23)27-35-17-21(37-27)15-13-19-9-11-20(12-10-19)14-16-22-18-36-28(38-22)30-41-25(33-7-3)26(42-30)34-8-4/h9-12,17-18H,5-8H2,1-4H3 |
| InChIKey | DCIKJHZGSCKPAD-UHFFFAOYSA-N |
| XLogP | 13.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.34 |
| LogP ≤ 5 | 13.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|