C22H20S4 — CID 102302110
2-(1,3-dithiol-2-ylidene)-4-[2-(2-ethynyl-4-hexylphenyl)ethynyl]-1,3-dithiole (PubChem CID 102302110) has the molecular formula C22H20S4 and a molecular weight of 412.67 g/mol. Its IUPAC name is 2-(1,3-dithiol-2-ylidene)-4-[2-(2-ethynyl-4-hexylphenyl)ethynyl]-1,3-dithiole.
| Compound Name | 2-(1,3-dithiol-2-ylidene)-4-[2-(2-ethynyl-4-hexylphenyl)ethynyl]-1,3-dithiole |
|---|---|
| PubChem CID | 102302110 |
| Molecular Formula | C22H20S4 |
| Molecular Weight | 412.67 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 2-(1,3-dithiol-2-ylidene)-4-[2-(2-ethynyl-4-hexylphenyl)ethynyl]-1,3-dithiole |
| SMILES | C#Cc1cc(CCCCCC)ccc1C#CC1=CSC(=C2SC=CS2)S1 |
| InChI | InChI=1S/C22H20S4/c1-3-5-6-7-8-17-9-10-19(18(4-2)15-17)11-12-20-16-25-22(26-20)21-23-13-14-24-21/h2,9-10,13-16H,3,5-8H2,1H3 |
| InChIKey | OUASJDPMTMUNNS-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.67 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|