C22H36S4 — CID 58220484
(2E)-4-octyl-2-(4-octyl-1,3-dithiol-2-ylidene)-1,3-dithiole (PubChem CID 58220484) has the molecular formula C22H36S4 and a molecular weight of 428.80 g/mol. Its IUPAC name is (2E)-4-octyl-2-(4-octyl-1,3-dithiol-2-ylidene)-1,3-dithiole.
| Compound Name | (2E)-4-octyl-2-(4-octyl-1,3-dithiol-2-ylidene)-1,3-dithiole |
|---|---|
| PubChem CID | 58220484 |
| Molecular Formula | C22H36S4 |
| Molecular Weight | 428.80 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | (2E)-4-octyl-2-(4-octyl-1,3-dithiol-2-ylidene)-1,3-dithiole |
| SMILES | CCCCCCCCC1=CS/C(=C2/SC=C(CCCCCCCC)S2)S1 |
| InChI | InChI=1S/C22H36S4/c1-3-5-7-9-11-13-15-19-17-23-21(25-19)22-24-18-20(26-22)16-14-12-10-8-6-4-2/h17-18H,3-16H2,1-2H3/b22-21+ |
| InChIKey | PWIYWVOFHIATSW-QURGRASLSA-N |
| XLogP | 10.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.80 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|