C21H31NS7 — CID 101253026
3-[[2-[4,5-bis(hexylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-dithiol-4-yl]sulfanyl]propanenitrile (PubChem CID 101253026) has the molecular formula C21H31NS7 and a molecular weight of 521.96 g/mol. Its IUPAC name is 3-[[2-[4,5-bis(hexylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-dithiol-4-yl]sulfanyl]propanenitrile.
| Compound Name | 3-[[2-[4,5-bis(hexylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-dithiol-4-yl]sulfanyl]propanenitrile |
|---|---|
| PubChem CID | 101253026 |
| Molecular Formula | C21H31NS7 |
| Molecular Weight | 521.96 g/mol |
| Exact Mass | 521.05 |
| IUPAC Name | 3-[[2-[4,5-bis(hexylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-dithiol-4-yl]sulfanyl]propanenitrile |
| SMILES | CCCCCCSC1=C(SCCCCCC)SC(=C2SC=C(SCCC#N)S2)S1 |
| InChI | InChI=1S/C21H31NS7/c1-3-5-7-9-13-24-18-19(25-14-10-8-6-4-2)29-21(28-18)20-26-16-17(27-20)23-15-11-12-22/h16H,3-11,13-15H2,1-2H3 |
| InChIKey | BDPMGUAVDWGQLN-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.96 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|