C48H54S18 — CID 101172055
6,13,20-tris[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-5,7,12,14,19,21-hexathiatetracyclo[16.3.0.04,8.011,15]henicosa-1(18),4(8),11(15)-trien-2,9,16-triyne (PubChem CID 101172055) has the molecular formula C48H54S18 and a molecular weight of 1208.17 g/mol. Its IUPAC name is 6,13,20-tris[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-5,7,12,14,19,21-hexathiatetracyclo[16.3.0.04,8.011,15]henicosa-1(18),4(8),11(15)-trien-2,9,16-triyne.
| Compound Name | 6,13,20-tris[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-5,7,12,14,19,21-hexathiatetracyclo[16.3.0.04,8.011,15]henicosa-1(18),4(8),11(15)-trien-2,9,16-triyne |
|---|---|
| PubChem CID | 101172055 |
| Molecular Formula | C48H54S18 |
| Molecular Weight | 1208.17 g/mol |
| Exact Mass | 1205.92 |
| IUPAC Name | 6,13,20-tris[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]-5,7,12,14,19,21-hexathiatetracyclo[16.3.0.04,8.011,15]henicosa-1(18),4(8),11(15)-trien-2,9,16-triyne |
| SMILES | CCCCSC1=C(SCCCC)SC(=c2sc3c#cc4sc(=C5SC(SCCCC)=C(SCCCC)S5)sc4c#cc4sc(=C5SC(SCCCC)=C(SCCCC)S5)sc4c#cc3s2)S1 |
| InChI | InChI=1S/C48H54S18/c1-7-13-25-49-37-38(50-26-14-8-2)62-46(61-37)43-55-31-19-21-33-35(59-44(57-33)47-63-39(51-27-15-9-3)40(64-47)52-28-16-10-4)23-24-36-34(22-20-32(31)56-43)58-45(60-36)48-65-41(53-29-17-11-5)42(66-48)54-30-18-12-6/h7-18,25-30H2,1-6H3 |
| InChIKey | FSLVDZMBHYPMFK-UHFFFAOYSA-N |
| XLogP | 21.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1208.17 |
| LogP ≤ 5 | 21.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|