C32H40S3 — CID 11049619
2,5-bis[(1E,3E)-4-(5-hexylthiophen-2-yl)buta-1,3-dienyl]thiophene (PubChem CID 11049619) has the molecular formula C32H40S3 and a molecular weight of 520.87 g/mol. Its IUPAC name is 2,5-bis[(1E,3E)-4-(5-hexylthiophen-2-yl)buta-1,3-dienyl]thiophene.
| Compound Name | 2,5-bis[(1E,3E)-4-(5-hexylthiophen-2-yl)buta-1,3-dienyl]thiophene |
|---|---|
| PubChem CID | 11049619 |
| Molecular Formula | C32H40S3 |
| Molecular Weight | 520.87 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 2,5-bis[(1E,3E)-4-(5-hexylthiophen-2-yl)buta-1,3-dienyl]thiophene |
| SMILES | CCCCCCc1ccc(/C=C/C=C/c2ccc(/C=C/C=C/c3ccc(CCCCCC)s3)s2)s1 |
| InChI | InChI=1S/C32H40S3/c1-3-5-7-9-15-27-21-23-29(33-27)17-11-13-19-31-25-26-32(35-31)20-14-12-18-30-24-22-28(34-30)16-10-8-6-4-2/h11-14,17-26H,3-10,15-16H2,1-2H3/b17-11+,18-12+,19-13+,20-14+ |
| InChIKey | BAGKXRZPYSZWQZ-JHTXPFLLSA-N |
| XLogP | 11.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.87 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|