C30H42N2O2S2 — CID 118156859
(3Z,6Z)-3,6-bis[(5-octylthiophen-2-yl)methylidene]piperazine-2,5-dione (PubChem CID 118156859) has the molecular formula C30H42N2O2S2 and a molecular weight of 526.81 g/mol. Its IUPAC name is (3Z,6Z)-3,6-bis[(5-octylthiophen-2-yl)methylidene]piperazine-2,5-dione.
| Compound Name | (3Z,6Z)-3,6-bis[(5-octylthiophen-2-yl)methylidene]piperazine-2,5-dione |
|---|---|
| PubChem CID | 118156859 |
| Molecular Formula | C30H42N2O2S2 |
| Molecular Weight | 526.81 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | (3Z,6Z)-3,6-bis[(5-octylthiophen-2-yl)methylidene]piperazine-2,5-dione |
| SMILES | CCCCCCCCc1ccc(/C=c2\[nH]c(=O)/c(=C/c3ccc(CCCCCCCC)s3)[nH]c2=O)s1 |
| InChI | InChI=1S/C30H42N2O2S2/c1-3-5-7-9-11-13-15-23-17-19-25(35-23)21-27-29(33)32-28(30(34)31-27)22-26-20-18-24(36-26)16-14-12-10-8-6-4-2/h17-22H,3-16H2,1-2H3,(H,31,34)(H,32,33)/b27-21-,28-22- |
| InChIKey | RVRAJRPFVNSPHJ-ZDSKVHJSSA-N |
| XLogP | 6.65 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.81 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|