C26H34N2O2S2 — CID 118156869
(3Z,6Z)-3,6-bis[(5-hexylthiophen-2-yl)methylidene]piperazine-2,5-dione (PubChem CID 118156869) has the molecular formula C26H34N2O2S2 and a molecular weight of 470.70 g/mol. Its IUPAC name is (3Z,6Z)-3,6-bis[(5-hexylthiophen-2-yl)methylidene]piperazine-2,5-dione.
| Compound Name | (3Z,6Z)-3,6-bis[(5-hexylthiophen-2-yl)methylidene]piperazine-2,5-dione |
|---|---|
| PubChem CID | 118156869 |
| Molecular Formula | C26H34N2O2S2 |
| Molecular Weight | 470.70 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | (3Z,6Z)-3,6-bis[(5-hexylthiophen-2-yl)methylidene]piperazine-2,5-dione |
| SMILES | CCCCCCc1ccc(/C=c2\[nH]c(=O)/c(=C/c3ccc(CCCCCC)s3)[nH]c2=O)s1 |
| InChI | InChI=1S/C26H34N2O2S2/c1-3-5-7-9-11-19-13-15-21(31-19)17-23-25(29)28-24(26(30)27-23)18-22-16-14-20(32-22)12-10-8-6-4-2/h13-18H,3-12H2,1-2H3,(H,27,30)(H,28,29)/b23-17-,24-18- |
| InChIKey | BIBAGPZHRCPXJF-BOYKQRMESA-N |
| XLogP | 5.09 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.70 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|