C19H27N3S — CID 144597145
[6-(aminomethyl)-4-[(E)-2-(5-hexylthiophen-2-yl)ethenyl]-2-pyridinyl]methanamine (PubChem CID 144597145) has the molecular formula C19H27N3S and a molecular weight of 329.51 g/mol. Its IUPAC name is [6-(aminomethyl)-4-[(E)-2-(5-hexylthiophen-2-yl)ethenyl]-2-pyridinyl]methanamine.
| Compound Name | [6-(aminomethyl)-4-[(E)-2-(5-hexylthiophen-2-yl)ethenyl]-2-pyridinyl]methanamine |
|---|---|
| PubChem CID | 144597145 |
| Molecular Formula | C19H27N3S |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | [6-(aminomethyl)-4-[(E)-2-(5-hexylthiophen-2-yl)ethenyl]-2-pyridinyl]methanamine |
| SMILES | CCCCCCc1ccc(/C=C/c2cc(CN)nc(CN)c2)s1 |
| InChI | InChI=1S/C19H27N3S/c1-2-3-4-5-6-18-9-10-19(23-18)8-7-15-11-16(13-20)22-17(12-15)14-21/h7-12H,2-6,13-14,20-21H2,1H3/b8-7+ |
| InChIKey | PWULMGFDEHLIDP-BQYQJAHWSA-N |
| XLogP | 4.35 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|