C21H24F3N3S — CID 140648751
4-[(E)-2-(5-hexylthiophen-2-yl)ethenyl]-2-[3-(trifluoromethyl)-2,3-dihydro-1H-pyrazol-5-yl]pyridine (PubChem CID 140648751) has the molecular formula C21H24F3N3S and a molecular weight of 407.51 g/mol. Its IUPAC name is 4-[(E)-2-(5-hexylthiophen-2-yl)ethenyl]-2-[3-(trifluoromethyl)-2,3-dihydro-1H-pyrazol-5-yl]pyridine.
| Compound Name | 4-[(E)-2-(5-hexylthiophen-2-yl)ethenyl]-2-[3-(trifluoromethyl)-2,3-dihydro-1H-pyrazol-5-yl]pyridine |
|---|---|
| PubChem CID | 140648751 |
| Molecular Formula | C21H24F3N3S |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 4-[(E)-2-(5-hexylthiophen-2-yl)ethenyl]-2-[3-(trifluoromethyl)-2,3-dihydro-1H-pyrazol-5-yl]pyridine |
| SMILES | CCCCCCc1ccc(/C=C/c2ccnc(C3=CC(C(F)(F)F)NN3)c2)s1 |
| InChI | InChI=1S/C21H24F3N3S/c1-2-3-4-5-6-16-9-10-17(28-16)8-7-15-11-12-25-18(13-15)19-14-20(27-26-19)21(22,23)24/h7-14,20,26-27H,2-6H2,1H3/b8-7+ |
| InChIKey | IBLVBQJOYJTFCH-BQYQJAHWSA-N |
| XLogP | 5.82 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|