C16H22IS4+ — CID 154075831
bis(5-butylsulfanylthiophen-2-yl)iodanium (PubChem CID 154075831) has the molecular formula C16H22IS4+ and a molecular weight of 469.52 g/mol. Its IUPAC name is bis(5-butylsulfanylthiophen-2-yl)iodanium.
| Compound Name | bis(5-butylsulfanylthiophen-2-yl)iodanium |
|---|---|
| PubChem CID | 154075831 |
| Molecular Formula | C16H22IS4+ |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 468.96 |
| IUPAC Name | bis(5-butylsulfanylthiophen-2-yl)iodanium |
| SMILES | CCCCSc1ccc([I+]c2ccc(SCCCC)s2)s1 |
| InChI | InChI=1S/C16H22IS4/c1-3-5-11-18-15-9-7-13(20-15)17-14-8-10-16(21-14)19-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3/q+1 |
| InChIKey | YGPIZFWAXOAWRJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|