C22H21Cl3S5Si — CID 59687604
trichloro-[5-[5-[5-(5-hexylsulfanylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]silane (PubChem CID 59687604) has the molecular formula C22H21Cl3S5Si and a molecular weight of 580.19 g/mol. Its IUPAC name is trichloro-[5-[5-[5-(5-hexylsulfanylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]silane.
| Compound Name | trichloro-[5-[5-[5-(5-hexylsulfanylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]silane |
|---|---|
| PubChem CID | 59687604 |
| Molecular Formula | C22H21Cl3S5Si |
| Molecular Weight | 580.19 g/mol |
| Exact Mass | 577.91 |
| IUPAC Name | trichloro-[5-[5-[5-(5-hexylsulfanylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]silane |
| SMILES | CCCCCCSc1ccc(-c2ccc(-c3ccc(-c4ccc([Si](Cl)(Cl)Cl)s4)s3)s2)s1 |
| InChI | InChI=1S/C22H21Cl3S5Si/c1-2-3-4-5-14-26-21-12-10-19(29-21)17-8-6-15(27-17)16-7-9-18(28-16)20-11-13-22(30-20)31(23,24)25/h6-13H,2-5,14H2,1H3 |
| InChIKey | ZFNGMLDMPFZXJZ-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.19 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|