C30H25N3O4S3 — CID 129070298
2-(4-carboxy-2-pyridinyl)-6-[4-[5-(5-pentylsulfanylthiophen-2-yl)thiophen-2-yl]-2-pyridinyl]pyridine-4-carboxylic acid (PubChem CID 129070298) has the molecular formula C30H25N3O4S3 and a molecular weight of 587.75 g/mol. Its IUPAC name is 2-(4-carboxy-2-pyridinyl)-6-[4-[5-(5-pentylsulfanylthiophen-2-yl)thiophen-2-yl]-2-pyridinyl]pyridine-4-carboxylic acid.
| Compound Name | 2-(4-carboxy-2-pyridinyl)-6-[4-[5-(5-pentylsulfanylthiophen-2-yl)thiophen-2-yl]-2-pyridinyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 129070298 |
| Molecular Formula | C30H25N3O4S3 |
| Molecular Weight | 587.75 g/mol |
| Exact Mass | 587.10 |
| IUPAC Name | 2-(4-carboxy-2-pyridinyl)-6-[4-[5-(5-pentylsulfanylthiophen-2-yl)thiophen-2-yl]-2-pyridinyl]pyridine-4-carboxylic acid |
| SMILES | CCCCCSc1ccc(-c2ccc(-c3ccnc(-c4cc(C(=O)O)cc(-c5cc(C(=O)O)ccn5)n4)c3)s2)s1 |
| InChI | InChI=1S/C30H25N3O4S3/c1-2-3-4-13-38-28-8-7-27(40-28)26-6-5-25(39-26)18-9-11-31-21(14-18)23-16-20(30(36)37)17-24(33-23)22-15-19(29(34)35)10-12-32-22/h5-12,14-17H,2-4,13H2,1H3,(H,34,35)(H,36,37) |
| InChIKey | FIPAMOYNIZVHRE-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 113.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.75 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|