C23H22F3N3S3 — CID 145155854
5-[5-(5-hexylsulfanylthiophen-2-yl)thiophen-2-yl]-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine (PubChem CID 145155854) has the molecular formula C23H22F3N3S3 and a molecular weight of 493.65 g/mol. Its IUPAC name is 5-[5-(5-hexylsulfanylthiophen-2-yl)thiophen-2-yl]-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine.
| Compound Name | 5-[5-(5-hexylsulfanylthiophen-2-yl)thiophen-2-yl]-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
|---|---|
| PubChem CID | 145155854 |
| Molecular Formula | C23H22F3N3S3 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | 5-[5-(5-hexylsulfanylthiophen-2-yl)thiophen-2-yl]-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
| SMILES | CCCCCCSc1ccc(-c2ccc(-c3ccc(-c4cc(C(F)(F)F)[nH]n4)nc3)s2)s1 |
| InChI | InChI=1S/C23H22F3N3S3/c1-2-3-4-5-12-30-22-11-10-20(32-22)19-9-8-18(31-19)15-6-7-16(27-14-15)17-13-21(29-28-17)23(24,25)26/h6-11,13-14H,2-5,12H2,1H3,(H,28,29) |
| InChIKey | PSJSGTKEXUTHBK-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|