C21H24F3N3OS — CID 90306583
1-(5-hexylthiophen-2-yl)-2-[2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]-4-pyridinyl]ethanol (PubChem CID 90306583) has the molecular formula C21H24F3N3OS and a molecular weight of 423.50 g/mol. Its IUPAC name is 1-(5-hexylthiophen-2-yl)-2-[2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]-4-pyridinyl]ethanol.
| Compound Name | 1-(5-hexylthiophen-2-yl)-2-[2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]-4-pyridinyl]ethanol |
|---|---|
| PubChem CID | 90306583 |
| Molecular Formula | C21H24F3N3OS |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 1-(5-hexylthiophen-2-yl)-2-[2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]-4-pyridinyl]ethanol |
| SMILES | CCCCCCc1ccc(C(O)Cc2ccnc(-c3cc(C(F)(F)F)[nH]n3)c2)s1 |
| InChI | InChI=1S/C21H24F3N3OS/c1-2-3-4-5-6-15-7-8-19(29-15)18(28)12-14-9-10-25-16(11-14)17-13-20(27-26-17)21(22,23)24/h7-11,13,18,28H,2-6,12H2,1H3,(H,26,27) |
| InChIKey | VCWPZHATHNRKKB-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|