C32H52S3Si2 — CID 101486953
[5-[5-[5-[dimethyl(octyl)silyl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-dimethyl-octylsilane (PubChem CID 101486953) has the molecular formula C32H52S3Si2 and a molecular weight of 589.14 g/mol. Its IUPAC name is [5-[5-[5-[dimethyl(octyl)silyl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-dimethyl-octylsilane.
| Compound Name | [5-[5-[5-[dimethyl(octyl)silyl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-dimethyl-octylsilane |
|---|---|
| PubChem CID | 101486953 |
| Molecular Formula | C32H52S3Si2 |
| Molecular Weight | 589.14 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | [5-[5-[5-[dimethyl(octyl)silyl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-dimethyl-octylsilane |
| SMILES | CCCCCCCC[Si](C)(C)c1ccc(-c2ccc(-c3ccc([Si](C)(C)CCCCCCCC)s3)s2)s1 |
| InChI | InChI=1S/C32H52S3Si2/c1-7-9-11-13-15-17-25-36(3,4)31-23-21-29(34-31)27-19-20-28(33-27)30-22-24-32(35-30)37(5,6)26-18-16-14-12-10-8-2/h19-24H,7-18,25-26H2,1-6H3 |
| InChIKey | OACCCODPTWBPEC-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.14 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|