C64H68S12Si5 — CID 101345806
tetrakis[2-[dimethyl-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]silyl]ethyl]silane (PubChem CID 101345806) has the molecular formula C64H68S12Si5 and a molecular weight of 1362.48 g/mol. Its IUPAC name is tetrakis[2-[dimethyl-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]silyl]ethyl]silane.
| Compound Name | tetrakis[2-[dimethyl-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]silyl]ethyl]silane |
|---|---|
| PubChem CID | 101345806 |
| Molecular Formula | C64H68S12Si5 |
| Molecular Weight | 1362.48 g/mol |
| Exact Mass | 1360.08 |
| IUPAC Name | tetrakis[2-[dimethyl-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]silyl]ethyl]silane |
| SMILES | C[Si](C)(CC[Si](CC[Si](C)(C)c1ccc(-c2ccc(-c3cccs3)s2)s1)(CC[Si](C)(C)c1ccc(-c2ccc(-c3cccs3)s2)s1)CC[Si](C)(C)c1ccc(-c2ccc(-c3cccs3)s2)s1)c1ccc(-c2ccc(-c3cccs3)s2)s1 |
| InChI | InChI=1S/C64H68S12Si5/c1-77(2,61-29-25-57(73-61)53-21-17-49(69-53)45-13-9-33-65-45)37-41-81(42-38-78(3,4)62-30-26-58(74-62)54-22-18-50(70-54)46-14-10-34-66-46,43-39-79(5,6)63-31-27-59(75-63)55-23-19-51(71-55)47-15-11-35-67-47)44-40-80(7,8)64-32-28-60(76-64)56-24-20-52(72-56)48-16-12-36-68-48/h9-36H,37-44H2,1-8H3 |
| InChIKey | QJXXYYXOUBMTHF-UHFFFAOYSA-N |
| XLogP | 23.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1362.48 |
| LogP ≤ 5 | 23.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|