C18H22O3S3Si — CID 59664325
triethoxy-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]silane (PubChem CID 59664325) has the molecular formula C18H22O3S3Si and a molecular weight of 410.66 g/mol. Its IUPAC name is triethoxy-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]silane.
| Compound Name | triethoxy-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]silane |
|---|---|
| PubChem CID | 59664325 |
| Molecular Formula | C18H22O3S3Si |
| Molecular Weight | 410.66 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | triethoxy-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]silane |
| SMILES | CCO[Si](OCC)(OCC)c1ccc(-c2ccc(-c3cccs3)s2)s1 |
| InChI | InChI=1S/C18H22O3S3Si/c1-4-19-25(20-5-2,21-6-3)18-12-11-17(24-18)16-10-9-15(23-16)14-8-7-13-22-14/h7-13H,4-6H2,1-3H3 |
| InChIKey | IHIDLGOUVFNOGV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.66 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|