C44H58S6Si2 — CID 101486956
[5-[5-[5-[5-[5-[5-[dimethyl(octyl)silyl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-dimethyl-octylsilane (PubChem CID 101486956) has the molecular formula C44H58S6Si2 and a molecular weight of 835.52 g/mol. Its IUPAC name is [5-[5-[5-[5-[5-[5-[dimethyl(octyl)silyl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-dimethyl-octylsilane.
| Compound Name | [5-[5-[5-[5-[5-[5-[dimethyl(octyl)silyl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-dimethyl-octylsilane |
|---|---|
| PubChem CID | 101486956 |
| Molecular Formula | C44H58S6Si2 |
| Molecular Weight | 835.52 g/mol |
| Exact Mass | 834.24 |
| IUPAC Name | [5-[5-[5-[5-[5-[5-[dimethyl(octyl)silyl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-dimethyl-octylsilane |
| SMILES | CCCCCCCC[Si](C)(C)c1ccc(-c2ccc(-c3ccc(-c4ccc(-c5ccc(-c6ccc([Si](C)(C)CCCCCCCC)s6)s5)s4)s3)s2)s1 |
| InChI | InChI=1S/C44H58S6Si2/c1-7-9-11-13-15-17-31-51(3,4)43-29-27-41(49-43)39-25-23-37(47-39)35-21-19-33(45-35)34-20-22-36(46-34)38-24-26-40(48-38)42-28-30-44(50-42)52(5,6)32-18-16-14-12-10-8-2/h19-30H,7-18,31-32H2,1-6H3 |
| InChIKey | ACUODSYYKGLAMT-UHFFFAOYSA-N |
| XLogP | 16.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.52 |
| LogP ≤ 5 | 16.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|