C15H24OS2 — CID 10469146
5-decylsulfanylthiophene-2-carbaldehyde (PubChem CID 10469146) has the molecular formula C15H24OS2 and a molecular weight of 284.49 g/mol. Its IUPAC name is 5-decylsulfanylthiophene-2-carbaldehyde.
| Compound Name | 5-decylsulfanylthiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 10469146 |
| Molecular Formula | C15H24OS2 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 5-decylsulfanylthiophene-2-carbaldehyde |
| SMILES | CCCCCCCCCCSc1ccc(C=O)s1 |
| InChI | InChI=1S/C15H24OS2/c1-2-3-4-5-6-7-8-9-12-17-15-11-10-14(13-16)18-15/h10-11,13H,2-9,12H2,1H3 |
| InChIKey | WWDXFTQIQSQCJK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|