C11H12S3 — CID 100914409
2-propylsulfanyl-5-thiophen-2-ylthiophene (PubChem CID 100914409) has the molecular formula C11H12S3 and a molecular weight of 240.42 g/mol. Its IUPAC name is 2-propylsulfanyl-5-thiophen-2-ylthiophene.
| Compound Name | 2-propylsulfanyl-5-thiophen-2-ylthiophene |
|---|---|
| PubChem CID | 100914409 |
| Molecular Formula | C11H12S3 |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 2-propylsulfanyl-5-thiophen-2-ylthiophene |
| SMILES | CCCSc1ccc(-c2cccs2)s1 |
| InChI | InChI=1S/C11H12S3/c1-2-7-13-11-6-5-10(14-11)9-4-3-8-12-9/h3-6,8H,2,7H2,1H3 |
| InChIKey | JVZGPCUAWDJGPT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |