C44H66S4 — CID 10010113
3,4-dibutyl-2-butylsulfanyl-5-[(1E,3E,5E,7E,9E,11E)-12-(3,4-dibutyl-5-butylsulfanylthiophen-2-yl)dodeca-1,3,5,7,9,11-hexaenyl]thiophene (PubChem CID 10010113) has the molecular formula C44H66S4 and a molecular weight of 723.28 g/mol. Its IUPAC name is 3,4-dibutyl-2-butylsulfanyl-5-[(1E,3E,5E,7E,9E,11E)-12-(3,4-dibutyl-5-butylsulfanylthiophen-2-yl)dodeca-1,3,5,7,9,11-hexaenyl]thiophene.
| Compound Name | 3,4-dibutyl-2-butylsulfanyl-5-[(1E,3E,5E,7E,9E,11E)-12-(3,4-dibutyl-5-butylsulfanylthiophen-2-yl)dodeca-1,3,5,7,9,11-hexaenyl]thiophene |
|---|---|
| PubChem CID | 10010113 |
| Molecular Formula | C44H66S4 |
| Molecular Weight | 723.28 g/mol |
| Exact Mass | 722.40 |
| IUPAC Name | 3,4-dibutyl-2-butylsulfanyl-5-[(1E,3E,5E,7E,9E,11E)-12-(3,4-dibutyl-5-butylsulfanylthiophen-2-yl)dodeca-1,3,5,7,9,11-hexaenyl]thiophene |
| SMILES | CCCCSc1sc(/C=C/C=C/C=C/C=C/C=C/C=C/c2sc(SCCCC)c(CCCC)c2CCCC)c(CCCC)c1CCCC |
| InChI | InChI=1S/C44H66S4/c1-7-13-29-37-39(31-15-9-3)43(45-35-17-11-5)47-41(37)33-27-25-23-21-19-20-22-24-26-28-34-42-38(30-14-8-2)40(32-16-10-4)44(48-42)46-36-18-12-6/h19-28,33-34H,7-18,29-32,35-36H2,1-6H3/b21-19+,22-20+,25-23+,26-24+,33-27+,34-28+ |
| InChIKey | PGVQOLISXSZRMY-DWOGCROXSA-N |
| XLogP | 15.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.28 |
| LogP ≤ 5 | 15.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|