C23H34OS2 — CID 10475525
(2E,4E,6E)-7-(3,4-dibutyl-5-butylsulfanylthiophen-2-yl)hepta-2,4,6-trienal (PubChem CID 10475525) has the molecular formula C23H34OS2 and a molecular weight of 390.66 g/mol. Its IUPAC name is (2E,4E,6E)-7-(3,4-dibutyl-5-butylsulfanylthiophen-2-yl)hepta-2,4,6-trienal.
| Compound Name | (2E,4E,6E)-7-(3,4-dibutyl-5-butylsulfanylthiophen-2-yl)hepta-2,4,6-trienal |
|---|---|
| PubChem CID | 10475525 |
| Molecular Formula | C23H34OS2 |
| Molecular Weight | 390.66 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | (2E,4E,6E)-7-(3,4-dibutyl-5-butylsulfanylthiophen-2-yl)hepta-2,4,6-trienal |
| SMILES | CCCCSc1sc(/C=C/C=C/C=C/C=O)c(CCCC)c1CCCC |
| InChI | InChI=1S/C23H34OS2/c1-4-7-15-20-21(16-8-5-2)23(25-19-9-6-3)26-22(20)17-13-11-10-12-14-18-24/h10-14,17-18H,4-9,15-16,19H2,1-3H3/b11-10+,14-12+,17-13+ |
| InChIKey | VESKRZKILIYUOY-CGRONNLVSA-N |
| XLogP | 7.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.66 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|