C19H30OS2 — CID 11724727
(E)-3-(3,4-dibutyl-5-butylsulfanylthiophen-2-yl)prop-2-enal (PubChem CID 11724727) has the molecular formula C19H30OS2 and a molecular weight of 338.58 g/mol. Its IUPAC name is (E)-3-(3,4-dibutyl-5-butylsulfanylthiophen-2-yl)prop-2-enal.
| Compound Name | (E)-3-(3,4-dibutyl-5-butylsulfanylthiophen-2-yl)prop-2-enal |
|---|---|
| PubChem CID | 11724727 |
| Molecular Formula | C19H30OS2 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (E)-3-(3,4-dibutyl-5-butylsulfanylthiophen-2-yl)prop-2-enal |
| SMILES | CCCCSc1sc(/C=C/C=O)c(CCCC)c1CCCC |
| InChI | InChI=1S/C19H30OS2/c1-4-7-11-16-17(12-8-5-2)19(21-15-9-6-3)22-18(16)13-10-14-20/h10,13-14H,4-9,11-12,15H2,1-3H3/b13-10+ |
| InChIKey | TVOGLLWUNRSMLI-JLHYYAGUSA-N |
| XLogP | 6.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|