C20H31BrS — CID 177415002
3-bromo-4-decyl-2,5-bis[(E)-prop-1-enyl]thiophene (PubChem CID 177415002) has the molecular formula C20H31BrS and a molecular weight of 383.44 g/mol. Its IUPAC name is 3-bromo-4-decyl-2,5-bis[(E)-prop-1-enyl]thiophene.
| Compound Name | 3-bromo-4-decyl-2,5-bis[(E)-prop-1-enyl]thiophene |
|---|---|
| PubChem CID | 177415002 |
| Molecular Formula | C20H31BrS |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 3-bromo-4-decyl-2,5-bis[(E)-prop-1-enyl]thiophene |
| SMILES | C/C=C/c1sc(/C=C/C)c(CCCCCCCCCC)c1Br |
| InChI | InChI=1S/C20H31BrS/c1-4-7-8-9-10-11-12-13-16-17-18(14-5-2)22-19(15-6-3)20(17)21/h5-6,14-15H,4,7-13,16H2,1-3H3/b14-5+,15-6+ |
| InChIKey | CRSYKKOCAVEEGV-PWSZKDBUSA-N |
| XLogP | 8.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|