C38H52N2O2S2 — CID 122663863
2-(4-decyl-5-methylthiophen-2-yl)-5-[4-decyl-5-[(E)-prop-1-enyl]thiophen-2-yl]pyrrolo[3,2-b]pyrrole-3,6-dione (PubChem CID 122663863) has the molecular formula C38H52N2O2S2 and a molecular weight of 632.98 g/mol. Its IUPAC name is 2-(4-decyl-5-methylthiophen-2-yl)-5-[4-decyl-5-[(E)-prop-1-enyl]thiophen-2-yl]pyrrolo[3,2-b]pyrrole-3,6-dione.
| Compound Name | 2-(4-decyl-5-methylthiophen-2-yl)-5-[4-decyl-5-[(E)-prop-1-enyl]thiophen-2-yl]pyrrolo[3,2-b]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 122663863 |
| Molecular Formula | C38H52N2O2S2 |
| Molecular Weight | 632.98 g/mol |
| Exact Mass | 632.35 |
| IUPAC Name | 2-(4-decyl-5-methylthiophen-2-yl)-5-[4-decyl-5-[(E)-prop-1-enyl]thiophen-2-yl]pyrrolo[3,2-b]pyrrole-3,6-dione |
| SMILES | C/C=C/c1sc(-c2nc3c(=O)c(-c4cc(CCCCCCCCCC)c(C)s4)nc=3c2=O)cc1CCCCCCCCCC |
| InChI | InChI=1S/C38H52N2O2S2/c1-5-8-10-12-14-16-18-20-23-28-25-31(43-27(28)4)33-37(41)35-36(39-33)38(42)34(40-35)32-26-29(30(44-32)22-7-3)24-21-19-17-15-13-11-9-6-2/h7,22,25-26H,5-6,8-21,23-24H2,1-4H3/b22-7+ |
| InChIKey | NCDMAVKBKBFURZ-QPJQQBGISA-N |
| XLogP | 10.96 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.98 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|