C25H33NO2S3 — CID 121369348
2-[5-[4-(2-aminoethyl)-5-(4-hexyl-5-methylthiophen-2-yl)thiophen-2-yl]-2-methylthiophen-3-yl]ethyl formate (PubChem CID 121369348) has the molecular formula C25H33NO2S3 and a molecular weight of 475.75 g/mol. Its IUPAC name is 2-[5-[4-(2-aminoethyl)-5-(4-hexyl-5-methylthiophen-2-yl)thiophen-2-yl]-2-methylthiophen-3-yl]ethyl formate.
| Compound Name | 2-[5-[4-(2-aminoethyl)-5-(4-hexyl-5-methylthiophen-2-yl)thiophen-2-yl]-2-methylthiophen-3-yl]ethyl formate |
|---|---|
| PubChem CID | 121369348 |
| Molecular Formula | C25H33NO2S3 |
| Molecular Weight | 475.75 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 2-[5-[4-(2-aminoethyl)-5-(4-hexyl-5-methylthiophen-2-yl)thiophen-2-yl]-2-methylthiophen-3-yl]ethyl formate |
| SMILES | CCCCCCc1cc(-c2sc(-c3cc(CCOC=O)c(C)s3)cc2CCN)sc1C |
| InChI | InChI=1S/C25H33NO2S3/c1-4-5-6-7-8-19-14-24(30-17(19)2)25-21(9-11-26)15-23(31-25)22-13-20(18(3)29-22)10-12-28-16-27/h13-16H,4-12,26H2,1-3H3 |
| InChIKey | XCNJQNYIGZHYMC-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.75 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|