C28H40O2S3 — CID 101104618
3-hexyl-2,5-bis(4-pentoxythiophen-2-yl)thiophene (PubChem CID 101104618) has the molecular formula C28H40O2S3 and a molecular weight of 504.83 g/mol. Its IUPAC name is 3-hexyl-2,5-bis(4-pentoxythiophen-2-yl)thiophene.
| Compound Name | 3-hexyl-2,5-bis(4-pentoxythiophen-2-yl)thiophene |
|---|---|
| PubChem CID | 101104618 |
| Molecular Formula | C28H40O2S3 |
| Molecular Weight | 504.83 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 3-hexyl-2,5-bis(4-pentoxythiophen-2-yl)thiophene |
| SMILES | CCCCCCc1cc(-c2cc(OCCCCC)cs2)sc1-c1cc(OCCCCC)cs1 |
| InChI | InChI=1S/C28H40O2S3/c1-4-7-10-11-14-22-17-26(25-18-23(20-31-25)29-15-12-8-5-2)33-28(22)27-19-24(21-32-27)30-16-13-9-6-3/h17-21H,4-16H2,1-3H3 |
| InChIKey | JNCXGAARTFOQFK-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.83 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|