C19H21NO2S3 — CID 121369347
2-[5-[4-(2-aminoethyl)-5-(5-methylthiophen-2-yl)thiophen-2-yl]-2-methylthiophen-3-yl]ethyl formate (PubChem CID 121369347) has the molecular formula C19H21NO2S3 and a molecular weight of 391.58 g/mol. Its IUPAC name is 2-[5-[4-(2-aminoethyl)-5-(5-methylthiophen-2-yl)thiophen-2-yl]-2-methylthiophen-3-yl]ethyl formate.
| Compound Name | 2-[5-[4-(2-aminoethyl)-5-(5-methylthiophen-2-yl)thiophen-2-yl]-2-methylthiophen-3-yl]ethyl formate |
|---|---|
| PubChem CID | 121369347 |
| Molecular Formula | C19H21NO2S3 |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 2-[5-[4-(2-aminoethyl)-5-(5-methylthiophen-2-yl)thiophen-2-yl]-2-methylthiophen-3-yl]ethyl formate |
| SMILES | Cc1ccc(-c2sc(-c3cc(CCOC=O)c(C)s3)cc2CCN)s1 |
| InChI | InChI=1S/C19H21NO2S3/c1-12-3-4-16(23-12)19-15(5-7-20)10-18(25-19)17-9-14(13(2)24-17)6-8-22-11-21/h3-4,9-11H,5-8,20H2,1-2H3 |
| InChIKey | KJXUOTRTKUALET-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|