C14H24N4S — CID 142646076
[3-methyl-4-(3-piperazin-1-ylpropylsulfanyl)-2-pyridinyl]methanamine (PubChem CID 142646076) has the molecular formula C14H24N4S and a molecular weight of 280.44 g/mol. Its IUPAC name is [3-methyl-4-(3-piperazin-1-ylpropylsulfanyl)-2-pyridinyl]methanamine.
| Compound Name | [3-methyl-4-(3-piperazin-1-ylpropylsulfanyl)-2-pyridinyl]methanamine |
|---|---|
| PubChem CID | 142646076 |
| Molecular Formula | C14H24N4S |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | [3-methyl-4-(3-piperazin-1-ylpropylsulfanyl)-2-pyridinyl]methanamine |
| SMILES | Cc1c(SCCCN2CCNCC2)ccnc1CN |
| InChI | InChI=1S/C14H24N4S/c1-12-13(11-15)17-4-3-14(12)19-10-2-7-18-8-5-16-6-9-18/h3-4,16H,2,5-11,15H2,1H3 |
| InChIKey | CMFHYSQNLUGZQK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|