C29H32N4OS2 — CID 139767725
[1-[3-[[2-(3H-benzimidazol-5-ylsulfanylmethyl)-3-methyl-4-pyridinyl]sulfanyl]propyl]piperidin-4-yl]-phenylmethanone (PubChem CID 139767725) has the molecular formula C29H32N4OS2 and a molecular weight of 516.74 g/mol. Its IUPAC name is [1-[3-[[2-(3H-benzimidazol-5-ylsulfanylmethyl)-3-methyl-4-pyridinyl]sulfanyl]propyl]piperidin-4-yl]-phenylmethanone.
| Compound Name | [1-[3-[[2-(3H-benzimidazol-5-ylsulfanylmethyl)-3-methyl-4-pyridinyl]sulfanyl]propyl]piperidin-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 139767725 |
| Molecular Formula | C29H32N4OS2 |
| Molecular Weight | 516.74 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | [1-[3-[[2-(3H-benzimidazol-5-ylsulfanylmethyl)-3-methyl-4-pyridinyl]sulfanyl]propyl]piperidin-4-yl]-phenylmethanone |
| SMILES | Cc1c(SCCCN2CCC(C(=O)c3ccccc3)CC2)ccnc1CSc1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C29H32N4OS2/c1-21-27(19-36-24-8-9-25-26(18-24)32-20-31-25)30-13-10-28(21)35-17-5-14-33-15-11-23(12-16-33)29(34)22-6-3-2-4-7-22/h2-4,6-10,13,18,20,23H,5,11-12,14-17,19H2,1H3,(H,31,32) |
| InChIKey | OSCQZUUXOFEQFX-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.74 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|