C26H24N4O2S — CID 60563349
1-[4-(3H-benzimidazole-5-carbonyl)piperazin-1-yl]-2-phenyl-2-phenylsulfanylethanone (PubChem CID 60563349) has the molecular formula C26H24N4O2S and a molecular weight of 456.57 g/mol. Its IUPAC name is 1-[4-(3H-benzimidazole-5-carbonyl)piperazin-1-yl]-2-phenyl-2-phenylsulfanylethanone.
| Compound Name | 1-[4-(3H-benzimidazole-5-carbonyl)piperazin-1-yl]-2-phenyl-2-phenylsulfanylethanone |
|---|---|
| PubChem CID | 60563349 |
| Molecular Formula | C26H24N4O2S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 1-[4-(3H-benzimidazole-5-carbonyl)piperazin-1-yl]-2-phenyl-2-phenylsulfanylethanone |
| SMILES | O=C(c1ccc2nc[nH]c2c1)N1CCN(C(=O)C(Sc2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H24N4O2S/c31-25(20-11-12-22-23(17-20)28-18-27-22)29-13-15-30(16-14-29)26(32)24(19-7-3-1-4-8-19)33-21-9-5-2-6-10-21/h1-12,17-18,24H,13-16H2,(H,27,28) |
| InChIKey | GKKVDEMTFNSACX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |