C27H28N2O2 — CID 122214708
N-tert-butyl-3,4-bis(4-methoxyphenyl)isoquinolin-1-amine (PubChem CID 122214708) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is N-tert-butyl-3,4-bis(4-methoxyphenyl)isoquinolin-1-amine.
| Compound Name | N-tert-butyl-3,4-bis(4-methoxyphenyl)isoquinolin-1-amine |
|---|---|
| PubChem CID | 122214708 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | N-tert-butyl-3,4-bis(4-methoxyphenyl)isoquinolin-1-amine |
| SMILES | COc1ccc(-c2nc(NC(C)(C)C)c3ccccc3c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H28N2O2/c1-27(2,3)29-26-23-9-7-6-8-22(23)24(18-10-14-20(30-4)15-11-18)25(28-26)19-12-16-21(31-5)17-13-19/h6-17H,1-5H3,(H,28,29) |
| InChIKey | DADAMHQYUGZNIB-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |