About 5-methoxy-3,4-bis(4-methoxyphenyl)isoquinolin-1-amine
5-methoxy-3,4-bis(4-methoxyphenyl)isoquinolin-1-amine (PubChem CID 177413638) has the molecular formula C24H22N2O3
and a molecular weight of 386.45 g/mol. Its IUPAC name is 5-methoxy-3,4-bis(4-methoxyphenyl)isoquinolin-1-amine.
Molecular Properties
| Compound Name | 5-methoxy-3,4-bis(4-methoxyphenyl)isoquinolin-1-amine |
| PubChem CID | 177413638 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 5-methoxy-3,4-bis(4-methoxyphenyl)isoquinolin-1-amine |
| SMILES | COc1ccc(-c2nc(N)c3cccc(OC)c3c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H22N2O3/c1-27-17-11-7-15(8-12-17)21-22-19(5-4-6-20(22)29-3)24(25)26-23(21)16-9-13-18(28-2)14-10-16/h4-14H,1-3H3,(H2,25,26) |
| InChIKey | UYDIWJBASPJPCU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methoxy-3,4-bis(4-methoxyphenyl)isoquinolin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-3,4-bis(4-methoxyphenyl)isoquinolin-1-amine?
The IUPAC name of 5-methoxy-3,4-bis(4-methoxyphenyl)isoquinolin-1-amine (CID 177413638) is 5-methoxy-3,4-bis(4-methoxyphenyl)isoquinolin-1-amine.
What is the SMILES notation for 5-methoxy-3,4-bis(4-methoxyphenyl)isoquinolin-1-amine?
The canonical SMILES for 5-methoxy-3,4-bis(4-methoxyphenyl)isoquinolin-1-amine is COc1ccc(-c2nc(N)c3cccc(OC)c3c2-c2ccc(OC)cc2)cc1.
What is the InChIKey of 5-methoxy-3,4-bis(4-methoxyphenyl)isoquinolin-1-amine?
The InChIKey is UYDIWJBASPJPCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N2O3/c1-27-17-11-7-15(8-12-17)21-22-19(5-4-6-20(22)29-3)24(25)26-23(21)16-9-13-18(28-2)14-10-16/h4-14H,1-3H3,(H2,25,26).
What are the key properties of 5-methoxy-3,4-bis(4-methoxyphenyl)isoquinolin-1-amine?
5-methoxy-3,4-bis(4-methoxyphenyl)isoquinolin-1-amine has a molecular weight of 386.45 g/mol, XLogP of 5.18, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-3,4-bis(4-methoxyphenyl)isoquinolin-1-amine is sourced from PubChem (CID 177413638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).