C10H11N3O — CID 84661992
5-methoxyisoquinoline-1,4-diamine (PubChem CID 84661992) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is 5-methoxyisoquinoline-1,4-diamine.
| Compound Name | 5-methoxyisoquinoline-1,4-diamine |
|---|---|
| PubChem CID | 84661992 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 5-methoxyisoquinoline-1,4-diamine |
| SMILES | COc1cccc2c(N)ncc(N)c12 |
| InChI | InChI=1S/C10H11N3O/c1-14-8-4-2-3-6-9(8)7(11)5-13-10(6)12/h2-5H,11H2,1H3,(H2,12,13) |
| InChIKey | ICPGBFUQKPYBRA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |